Hippolide B
FEATURES
Loading...
NAMES
  • Hippolide B
SMILES
CO[C@H]1O[C@@H]([C@@H]2CC(=O)NC2=O)CC=C1CC/C=C(\C)CC/C=C(\C)CCC=C(C)C
InChI
InChI=1S/C26H39NO4/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21-15-16-23(31-26(21)30-5)22-17-24(28)27-25(22)29/h9,11,13,15,22-23,26H,6-8,10,12,14,16-17H2,1-5H3,(H,27,28,29)/b19-11+,20-13+/t22-,23+,26-/m0/s1
MOLECULAR FORMULA
C26H39NO4
CROSS REFERENCES
Loading...
Hippolide B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight429.29
AlogP5.54
HBond donors1
HBond acceptors5
Atoms70
Contains toxicophoreNo
Contains PAINSNo
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Hippolide B.