Tryprostatin B
FEATURES
Loading...
NAMES
  • Tryprostatin B
SMILES
CC(C)=CCc1[nH]c2ccccc2c1C[C@@H]1NC(=O)[C@@H]2CCCN2C1=O
InChI
InChI=1S/C21H25N3O2/c1-13(2)9-10-17-15(14-6-3-4-7-16(14)22-17)12-18-21(26)24-11-5-8-19(24)20(25)23-18/h3-4,6-7,9,18-19,22H,5,8,10-12H2,1-2H3,(H,23,25)/t18-,19-/m0/s1
MOLECULAR FORMULA
C21H25N3O2
CROSS REFERENCES
Loading...
Tryprostatin B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight351.19
AlogP2.71
HBond donors2
HBond acceptors5
Atoms51
Contains toxicophoreNo
Contains PAINSYes
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Tryprostatin B.