Riisein B
FEATURES
Loading...
NAMES
  • Riisein B
SMILES
CC(=O)OCC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)[C@@]4(O)C[C@@H](O[C@@H]5OC[C@@H](OC(C)=O)[C@@H](O)[C@@H]5O)CC[C@]4(C)[C@H]3CC[C@@]21C
InChI
InChI=1S/C36H60O10/c1-20(18-43-22(3)37)8-7-9-21(2)26-10-11-27-25-16-30(39)36(42)17-24(12-15-35(36,6)28(25)13-14-34(26,27)5)46-33-32(41)31(40)29(19-44-33)45-23(4)38/h20-21,24-33,39-42H,7-19H2,1-6H3/t20?,21-,24+,25+,26-,27+,28+,29-,30-,31-,32+,33+,34-,35-,36+/m1/s1
MOLECULAR FORMULA
C36H60O10
CROSS REFERENCES
Loading...
Riisein B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight652.42
AlogP4.13
HBond donors4
HBond acceptors10
Atoms106
Contains toxicophoreYes
Contains PAINSNo
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Riisein B.