Phyllofolactone B
FEATURES
Loading...
NAMES
  • Phyllofolactone B
SMILES
CC[C@@]1(C)CCC[C@@]2(C)[C@H]1CC[C@@]1(C)[C@@H]3CCC4=C(C(=O)O[C@H]4C)[C@@]3(C)[C@@H](O)C[C@H]21
InChI
InChI=1S/C27H42O3/c1-7-24(3)12-8-13-25(4)18(24)11-14-26(5)19-10-9-17-16(2)30-23(29)22(17)27(19,6)21(28)15-20(25)26/h16,18-21,28H,7-15H2,1-6H3/t16-,18-,19-,20+,21-,24-,25-,26-,27+/m0/s1
MOLECULAR FORMULA
C27H42O3
CROSS REFERENCES
Loading...
Phyllofolactone B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight414.31
AlogP6.05
HBond donors1
HBond acceptors3
Atoms72
Contains toxicophoreNo
Contains PAINSNo
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Phyllofolactone B.