Curculigoside B
FEATURES
Loading...
NAMES
  • Curculigoside B
SMILES
COc1cccc(O)c1C(=O)OCc1cc(O)ccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
InChI
InChI=1S/C21H24O11/c1-29-14-4-2-3-12(24)16(14)20(28)30-9-10-7-11(23)5-6-13(10)31-21-19(27)18(26)17(25)15(8-22)32-21/h2-7,15,17-19,21-27H,8-9H2,1H3/t15-,17-,18+,19-,21-/m1/s1
MOLECULAR FORMULA
C21H24O11
CROSS REFERENCES
Loading...
Curculigoside B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight452.13
AlogP-0.36
HBond donors6
HBond acceptors11
Atoms56
Contains toxicophoreNo
Contains PAINSNo
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Curculigoside B.