4-METHYL DESMOSDUMOTIN B
FEATURES
Loading...
NAMES
  • 4-Methyl Desmosdumotin B
SMILES
CC1=C(O)c2c(oc(-c3ccc(C)cc3)cc2=O)C(C)(C)C1=O
InChI
InChI=1S/C19H18O4/c1-10-5-7-12(8-6-10)14-9-13(20)15-16(21)11(2)17(22)19(3,4)18(15)23-14/h5-9,21H,1-4H3
MOLECULAR FORMULA
C19H18O4
CROSS REFERENCES
Loading...
4-METHYL DESMOSDUMOTIN B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight310.12
AlogP3.76
HBond donors1
HBond acceptors4
Atoms41
Contains toxicophoreNo
Contains PAINSNo
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by 4-METHYL DESMOSDUMOTIN B.