Nymphaeol B
FEATURES
Loading...
NAMES
  • Nymphaeol B
SMILES
CC(C)=CCC/C(C)=C/Cc1c([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)ccc(O)c1O
InChI
InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-8-18-17(9-10-19(27)25(18)30)22-13-21(29)24-20(28)11-16(26)12-23(24)31-22/h5,7,9-12,22,26-28,30H,4,6,8,13H2,1-3H3/b15-7+/t22-/m0/s1
MOLECULAR FORMULA
C25H28O6
CROSS REFERENCES
Loading...
Nymphaeol B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight424.19
AlogP5.45
HBond donors4
HBond acceptors6
Atoms59
Contains toxicophoreYes
Contains PAINSYes
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Nymphaeol B.