Isoniazid-related Nickel(II) complex analogue
FEATURES
Loading...
NAMES
  • Isoniazid-related Nickel(II) complex analogue
SMILES
COc1ccc(/C=N/N=C(\O[Ni]2(C)OC(c3ccncc3)=N/[N+]2=C\c2ccc(OC)c(F)c2)c2ccncc2)cc1F
InChI
InChI=1S/2C14H12FN3O2.CH3.Ni/c2*1-20-13-3-2-10(8-12(13)15)9-17-18-14(19)11-4-6-16-7-5-11;;/h2*2-9H,1H3,(H,18,19);1H3;/q;;;+3/p-2/b17-9+;17-9-;;
MOLECULAR FORMULA
C29H25F2N6NiO4+
CROSS REFERENCES
Loading...
Isoniazid-related Nickel(II) complex analogue
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight617.13
AlogP5.04
HBond donors0
HBond acceptors10
Atoms67
Contains toxicophoreYes
Contains PAINSNo
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Isoniazid-related Nickel(II) complex analogue.