Prenocardiamide B
FEATURES
Loading...
NAMES
  • Prenocardiamide B
SMILES
CC(C)C[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](N)C(C)C)C(C)C)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)C(C)C
InChI
InChI=1S/C35H58N6O8/c1-17(2)15-24(37-32(45)28(20(7)8)41-34(47)29(21(9)10)40-31(44)26(36)18(3)4)30(43)39-27(19(5)6)33(46)38-25(35(48)49)16-22-11-13-23(42)14-12-22/h11-14,17-21,24-29,42H,15-16,36H2,1-10H3,(H,37,45)(H,38,46)(H,39,43)(H,40,44)(H,41,47)(H,48,49)/t24-,25+,26-,27+,28-,29+/m1/s1
MOLECULAR FORMULA
C35H58N6O8
CROSS REFERENCES
Loading...
Prenocardiamide B
Compound Synopsis
OVERVIEW
PROPERTIES
Molecular weight690.43
AlogP1.44
HBond donors9
HBond acceptors14
Atoms107
Contains toxicophoreNo
Contains PAINSNo
Commercially availableUnknown
Property color indications are based on Lipinski's Ro5.
PROTEIN TARGETS
No information about proteins targeted by Prenocardiamide B.